C23H28N6O3S2 — CID 154455345
N-[4-[2-[4-[(2-amino-2-hydrazinylideneethyl)amino]phenyl]ethyl]-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 154455345) has the molecular formula C23H28N6O3S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is N-[4-[2-[4-[(2-amino-2-hydrazinylideneethyl)amino]phenyl]ethyl]-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-[(2-amino-2-hydrazinylideneethyl)amino]phenyl]ethyl]-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 154455345 |
| Molecular Formula | C23H28N6O3S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[4-[2-[4-[(2-amino-2-hydrazinylideneethyl)amino]phenyl]ethyl]-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(NCC(N)=NN)cc2)c(Cc2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C23H28N6O3S2/c1-15(30)27-23-28-20(12-7-16-3-8-18(9-4-16)26-14-22(24)29-25)21(33-23)13-17-5-10-19(11-6-17)34(2,31)32/h3-6,8-11,26H,7,12-14,25H2,1-2H3,(H2,24,29)(H,27,28,30) |
| InChIKey | FGTBJDOOPIRMFJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|