C18H28N6OS — CID 142927507
N-[5-[(dimethylamino)methyl]-4-[2-[4-(methylamino)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide;methanimidamide (PubChem CID 142927507) has the molecular formula C18H28N6OS and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-4-[2-[4-(methylamino)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide;methanimidamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-4-[2-[4-(methylamino)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide;methanimidamide |
|---|---|
| PubChem CID | 142927507 |
| Molecular Formula | C18H28N6OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-4-[2-[4-(methylamino)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide;methanimidamide |
| SMILES | CNc1ccc(CCc2nc(NC(C)=O)sc2CN(C)C)cc1.[H]/N=C/N |
| InChI | InChI=1S/C17H24N4OS.CH4N2/c1-12(22)19-17-20-15(16(23-17)11-21(3)4)10-7-13-5-8-14(18-2)9-6-13;2-1-3/h5-6,8-9,18H,7,10-11H2,1-4H3,(H,19,20,22);1H,(H3,2,3) |
| InChIKey | IVUDWANAEIEJDY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|