C25H30N4O3S2 — CID 175253709
N-[4-[2-(4-aminophenyl)ethyl]-5-[[4-[3-(dimethylamino)prop-2-enylsulfonyl]phenyl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 175253709) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[4-[2-(4-aminophenyl)ethyl]-5-[[4-[3-(dimethylamino)prop-2-enylsulfonyl]phenyl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-(4-aminophenyl)ethyl]-5-[[4-[3-(dimethylamino)prop-2-enylsulfonyl]phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 175253709 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[4-[2-(4-aminophenyl)ethyl]-5-[[4-[3-(dimethylamino)prop-2-enylsulfonyl]phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N)cc2)c(Cc2ccc(S(=O)(=O)CC=CN(C)C)cc2)s1 |
| InChI | InChI=1S/C25H30N4O3S2/c1-18(30)27-25-28-23(14-9-19-5-10-21(26)11-6-19)24(33-25)17-20-7-12-22(13-8-20)34(31,32)16-4-15-29(2)3/h4-8,10-13,15H,9,14,16-17,26H2,1-3H3,(H,27,28,30) |
| InChIKey | GOQRXQSIXJXXJF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|