C24H39N5O3S — CID 143109779
N-[4-[2-(4-aminophenyl)ethyl]-5-methyl-1,3-thiazol-2-yl]acetamide;N-(6-oxohexyl)formamide;propan-2-amine (PubChem CID 143109779) has the molecular formula C24H39N5O3S and a molecular weight of 477.68 g/mol. Its IUPAC name is N-[4-[2-(4-aminophenyl)ethyl]-5-methyl-1,3-thiazol-2-yl]acetamide;N-(6-oxohexyl)formamide;propan-2-amine.
| Compound Name | N-[4-[2-(4-aminophenyl)ethyl]-5-methyl-1,3-thiazol-2-yl]acetamide;N-(6-oxohexyl)formamide;propan-2-amine |
|---|---|
| PubChem CID | 143109779 |
| Molecular Formula | C24H39N5O3S |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N-[4-[2-(4-aminophenyl)ethyl]-5-methyl-1,3-thiazol-2-yl]acetamide;N-(6-oxohexyl)formamide;propan-2-amine |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N)cc2)c(C)s1.CC(C)N.O=CCCCCCNC=O |
| InChI | InChI=1S/C14H17N3OS.C7H13NO2.C3H9N/c1-9-13(17-14(19-9)16-10(2)18)8-5-11-3-6-12(15)7-4-11;9-6-4-2-1-3-5-8-7-10;1-3(2)4/h3-4,6-7H,5,8,15H2,1-2H3,(H,16,17,18);6-7H,1-5H2,(H,8,10);3H,4H2,1-2H3 |
| InChIKey | YDPCETQDUJCZHG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|