C19H25N3O4S — CID 14076218
ethyl 4-[2-[[2-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-hydroxyethyl]amino]ethyl]benzoate (PubChem CID 14076218) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is ethyl 4-[2-[[2-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-hydroxyethyl]amino]ethyl]benzoate.
| Compound Name | ethyl 4-[2-[[2-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-hydroxyethyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 14076218 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl 4-[2-[[2-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-hydroxyethyl]amino]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCNCC(O)c2sc(NC(C)=O)nc2C)cc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-4-26-18(25)15-7-5-14(6-8-15)9-10-20-11-16(24)17-12(2)21-19(27-17)22-13(3)23/h5-8,16,20,24H,4,9-11H2,1-3H3,(H,21,22,23) |
| InChIKey | CQCRZYBCGBOPKZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|