C11H14N2O5S — CID 20788327
diethyl 2-acetamido-1,3-thiazole-4,5-dicarboxylate (PubChem CID 20788327) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is diethyl 2-acetamido-1,3-thiazole-4,5-dicarboxylate.
| Compound Name | diethyl 2-acetamido-1,3-thiazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 20788327 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | diethyl 2-acetamido-1,3-thiazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(NC(C)=O)sc1C(=O)OCC |
| InChI | InChI=1S/C11H14N2O5S/c1-4-17-9(15)7-8(10(16)18-5-2)19-11(13-7)12-6(3)14/h4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | GGMDKSUKJWRKMX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |