C18H26N4O9S2 — CID 139067638
bis(diethyl 2-amino-1,3-thiazole-4,5-dicarboxylate);hydrate (PubChem CID 139067638) has the molecular formula C18H26N4O9S2 and a molecular weight of 506.56 g/mol. Its IUPAC name is bis(diethyl 2-amino-1,3-thiazole-4,5-dicarboxylate);hydrate.
| Compound Name | bis(diethyl 2-amino-1,3-thiazole-4,5-dicarboxylate);hydrate |
|---|---|
| PubChem CID | 139067638 |
| Molecular Formula | C18H26N4O9S2 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | bis(diethyl 2-amino-1,3-thiazole-4,5-dicarboxylate);hydrate |
| SMILES | CCOC(=O)c1nc(N)sc1C(=O)OCC.CCOC(=O)c1nc(N)sc1C(=O)OCC.O |
| InChI | InChI=1S/2C9H12N2O4S.H2O/c2*1-3-14-7(12)5-6(8(13)15-4-2)16-9(10)11-5;/h2*3-4H2,1-2H3,(H2,10,11);1H2 |
| InChIKey | MUGZOAJGGNAKBG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 214.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|