C9H16N2O2S — CID 145143337
ethane;ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 145143337) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is ethane;ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethane;ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145143337 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | ethane;ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CC.CCOC(=O)c1nc(N)sc1C |
| InChI | InChI=1S/C7H10N2O2S.C2H6/c1-3-11-6(10)5-4(2)12-7(8)9-5;1-2/h3H2,1-2H3,(H2,8,9);1-2H3 |
| InChIKey | PWQQFUSEQCUZDW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |