C7H8ClNO2S — CID 53302340
ethyl 2-chloro-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 53302340) has the molecular formula C7H8ClNO2S and a molecular weight of 205.67 g/mol. Its IUPAC name is ethyl 2-chloro-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-chloro-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 53302340 |
| Molecular Formula | C7H8ClNO2S |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | ethyl 2-chloro-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(Cl)sc1C |
| InChI | InChI=1S/C7H8ClNO2S/c1-3-11-6(10)5-4(2)12-7(8)9-5/h3H2,1-2H3 |
| InChIKey | HPTJVXQXCVATIH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |