C13H16Cl3NO4 — CID 145166855
diethyl 3,4,5-trichloropyridine-2,6-dicarboxylate;ethane (PubChem CID 145166855) has the molecular formula C13H16Cl3NO4 and a molecular weight of 356.63 g/mol. Its IUPAC name is diethyl 3,4,5-trichloropyridine-2,6-dicarboxylate;ethane.
| Compound Name | diethyl 3,4,5-trichloropyridine-2,6-dicarboxylate;ethane |
|---|---|
| PubChem CID | 145166855 |
| Molecular Formula | C13H16Cl3NO4 |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | diethyl 3,4,5-trichloropyridine-2,6-dicarboxylate;ethane |
| SMILES | CC.CCOC(=O)c1nc(C(=O)OCC)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl3NO4.C2H6/c1-3-18-10(16)8-6(13)5(12)7(14)9(15-8)11(17)19-4-2;1-2/h3-4H2,1-2H3;1-2H3 |
| InChIKey | UQADVAQAUHBTJQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |