C17H14Cl4N2O5 — CID 3943120
[2-(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 3943120) has the molecular formula C17H14Cl4N2O5 and a molecular weight of 468.12 g/mol. Its IUPAC name is [2-(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | [2-(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3943120 |
| Molecular Formula | C17H14Cl4N2O5 |
| Molecular Weight | 468.12 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | [2-(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)c1C |
| InChI | InChI=1S/C17H14Cl4N2O5/c1-4-27-16(25)9-6(2)13(22-7(9)3)8(24)5-28-17(26)14-11(19)10(18)12(20)15(21)23-14/h22H,4-5H2,1-3H3 |
| InChIKey | XGVHBUVNMOJYOG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|