C26H20ClNO7 — CID 5176360
ethyl 5-[2-(1-chloro-9,10-dioxoanthracene-2-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 5176360) has the molecular formula C26H20ClNO7 and a molecular weight of 493.90 g/mol. Its IUPAC name is ethyl 5-[2-(1-chloro-9,10-dioxoanthracene-2-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(1-chloro-9,10-dioxoanthracene-2-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5176360 |
| Molecular Formula | C26H20ClNO7 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | ethyl 5-[2-(1-chloro-9,10-dioxoanthracene-2-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)c1C |
| InChI | InChI=1S/C26H20ClNO7/c1-4-34-26(33)19-12(2)22(28-13(19)3)18(29)11-35-25(32)17-10-9-16-20(21(17)27)24(31)15-8-6-5-7-14(15)23(16)30/h5-10,28H,4,11H2,1-3H3 |
| InChIKey | OAOBETSMOYEEPO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|