C26H21NO7 — CID 5239860
ethyl 5-[2-(9,10-dioxoanthracene-1-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 5239860) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is ethyl 5-[2-(9,10-dioxoanthracene-1-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-(9,10-dioxoanthracene-1-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5239860 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl 5-[2-(9,10-dioxoanthracene-1-carbonyl)oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)c1C |
| InChI | InChI=1S/C26H21NO7/c1-4-33-26(32)20-13(2)22(27-14(20)3)19(28)12-34-25(31)18-11-7-10-17-21(18)24(30)16-9-6-5-8-15(16)23(17)29/h5-11,27H,4,12H2,1-3H3 |
| InChIKey | MFMTYPWJAZKNPY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|