C17H10ClNO5 — CID 3418613
(2-amino-2-oxoethyl) 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 3418613) has the molecular formula C17H10ClNO5 and a molecular weight of 343.72 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 3418613 |
| Molecular Formula | C17H10ClNO5 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | (2-amino-2-oxoethyl) 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | NC(=O)COC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H10ClNO5/c18-14-11(17(23)24-7-12(19)20)6-5-10-13(14)16(22)9-4-2-1-3-8(9)15(10)21/h1-6H,7H2,(H2,19,20) |
| InChIKey | KUKVFZNBSDZJOH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|