C22H18ClNO5 — CID 9018368
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 9018368) has the molecular formula C22H18ClNO5 and a molecular weight of 411.84 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 9018368 |
| Molecular Formula | C22H18ClNO5 |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O)C1CC1 |
| InChI | InChI=1S/C22H18ClNO5/c1-11(12-6-7-12)24-17(25)10-29-22(28)16-9-8-15-18(19(16)23)21(27)14-5-3-2-4-13(14)20(15)26/h2-5,8-9,11-12H,6-7,10H2,1H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | GBQFHTCENUUUHX-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|