C17H17ClN2O3 — CID 8849352
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate (PubChem CID 8849352) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8849352 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc(Cl)nc2ccccc12)C1CC1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-10(11-6-7-11)19-16(21)9-23-17(22)13-8-15(18)20-14-5-3-2-4-12(13)14/h2-5,8,10-11H,6-7,9H2,1H3,(H,19,21)/t10-/m1/s1 |
| InChIKey | CKOROEIBOWKXBP-SNVBAGLBSA-N |
| XLogP | 2.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|