C19H21ClN2O3 — CID 9009469
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009469) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009469 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)c1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H21ClN2O3/c1-12-6-2-4-8-15(12)22-18(23)11-25-19(24)14-10-17(20)21-16-9-5-3-7-13(14)16/h3,5,7,9-10,12,15H,2,4,6,8,11H2,1H3,(H,22,23)/t12-,15-/m1/s1 |
| InChIKey | CRKHJWVZPIVPQO-IUODEOHRSA-N |
| XLogP | 3.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|