C22H21ClN2O3 — CID 9009329
[2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009329) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009329 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
| SMILES | CC[C@@H](NC(=O)COC(=O)c1cc(Cl)nc2ccccc12)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-3-18(15-10-8-14(2)9-11-15)25-21(26)13-28-22(27)17-12-20(23)24-19-7-5-4-6-16(17)19/h4-12,18H,3,13H2,1-2H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | IZIHLIAEFPDPAB-GOSISDBHSA-N |
| XLogP | 4.62 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|