C24H24N2O3 — CID 9330416
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 9330416) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 9330416 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCC(=O)N[C@H](C)C3CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-15-7-9-18(10-8-15)22-13-20(19-5-3-4-6-21(19)26-22)24(28)29-14-23(27)25-16(2)17-11-12-17/h3-10,13,16-17H,11-12,14H2,1-2H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | ZSXRXJJHBGUENS-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |