C25H18ClNO6 — CID 4181401
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 4181401) has the molecular formula C25H18ClNO6 and a molecular weight of 463.87 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 4181401 |
| Molecular Formula | C25H18ClNO6 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COc1ccc(CNC(=O)COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H18ClNO6/c1-32-15-8-6-14(7-9-15)12-27-20(28)13-33-25(31)19-11-10-18-21(22(19)26)24(30)17-5-3-2-4-16(17)23(18)29/h2-11H,12-13H2,1H3,(H,27,28) |
| InChIKey | FRRZENJDJIDXLT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|