C23H14Cl2O5 — CID 16521494
2-(3-chlorophenoxy)ethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16521494) has the molecular formula C23H14Cl2O5 and a molecular weight of 441.27 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 16521494 |
| Molecular Formula | C23H14Cl2O5 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(OCCOc1cccc(Cl)c1)c1ccc2c(c1Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H14Cl2O5/c24-13-4-3-5-14(12-13)29-10-11-30-23(28)18-9-8-17-19(20(18)25)22(27)16-7-2-1-6-15(16)21(17)26/h1-9,12H,10-11H2 |
| InChIKey | WEOTWORFWOVAFJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|