C23H16FNO5 — CID 46544063
2-(4-fluorophenoxy)ethyl 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 46544063) has the molecular formula C23H16FNO5 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 46544063 |
| Molecular Formula | C23H16FNO5 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Nc1c(C(=O)OCCOc2ccc(F)cc2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H16FNO5/c24-13-5-7-14(8-6-13)29-11-12-30-23(28)18-10-9-17-19(20(18)25)22(27)16-4-2-1-3-15(16)21(17)26/h1-10H,11-12,25H2 |
| InChIKey | JHOOKLVJNWVQDT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|