C25H20N2O7 — CID 3677014
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 3677014) has the molecular formula C25H20N2O7 and a molecular weight of 460.44 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 3677014 |
| Molecular Formula | C25H20N2O7 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2ccc3c(c2N)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C25H20N2O7/c1-32-13-7-10-19(33-2)18(11-13)27-20(28)12-34-25(31)17-9-8-16-21(22(17)26)24(30)15-6-4-3-5-14(15)23(16)29/h3-11H,12,26H2,1-2H3,(H,27,28) |
| InChIKey | IEXXOWHMJKBLSP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|