C19H18N2O5 — CID 7888845
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 7888845) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7888845 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-24-12-7-8-17(25-2)16(9-12)21-18(22)11-26-19(23)14-10-20-15-6-4-3-5-13(14)15/h3-10,20H,11H2,1-2H3,(H,21,22) |
| InChIKey | CBYDHZBKYAJHEO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |