C24H23NO5 — CID 4145246
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2,2-diphenylacetate (PubChem CID 4145246) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2,2-diphenylacetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 4145246 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2,2-diphenylacetate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO5/c1-28-19-13-14-21(29-2)20(15-19)25-22(26)16-30-24(27)23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-15,23H,16H2,1-2H3,(H,25,26) |
| InChIKey | HDJIVSIBZPWCCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |