C19H21NO6 — CID 8791367
[2-(2,5-dimethoxyanilino)-2-oxoethyl] (2R)-2-phenoxypropanoate (PubChem CID 8791367) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] (2R)-2-phenoxypropanoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8791367 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] (2R)-2-phenoxypropanoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)[C@@H](C)Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO6/c1-13(26-14-7-5-4-6-8-14)19(22)25-12-18(21)20-16-11-15(23-2)9-10-17(16)24-3/h4-11,13H,12H2,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | SPSMLQGDIBAORT-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |