C20H22N2O7 — CID 55884813
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-benzamido-3-hydroxypropanoate (PubChem CID 55884813) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-benzamido-3-hydroxypropanoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-benzamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 55884813 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-benzamido-3-hydroxypropanoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)C(CO)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O7/c1-27-14-8-9-17(28-2)15(10-14)21-18(24)12-29-20(26)16(11-23)22-19(25)13-6-4-3-5-7-13/h3-10,16,23H,11-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | JTPAWODWQADFSD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |