C28H30N2O6 — CID 46605778
[2-[1-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 46605778) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is [2-[1-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-[1-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 46605778 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-[1-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O6/c1-19(23-17-22(34-2)14-15-25(23)35-3)29-26(31)18-36-28(33)24(16-20-10-6-4-7-11-20)30-27(32)21-12-8-5-9-13-21/h4-15,17,19,24H,16,18H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | QJOORPLLIYVBDU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |