C26H25NO6 — CID 42970439
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 42970439) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 42970439 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | COc1ccc(C(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C26H25NO6/c1-31-20-13-14-21(24(16-20)32-2)23(28)17-33-26(30)22(15-18-9-5-3-6-10-18)27-25(29)19-11-7-4-8-12-19/h3-14,16,22H,15,17H2,1-2H3,(H,27,29) |
| InChIKey | LUKLIOMCBUZYEM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |