C28H32N2O5 — CID 42979328
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 42979328) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 42979328 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C28H32N2O5/c1-20-17-24(21(2)30(20)15-10-16-34-3)26(31)19-35-28(33)25(18-22-11-6-4-7-12-22)29-27(32)23-13-8-5-9-14-23/h4-9,11-14,17,25H,10,15-16,18-19H2,1-3H3,(H,29,32) |
| InChIKey | NQQFBWSMSRCVFG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|