C24H27NO4S — CID 7795775
[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 7795775) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 7795775 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | COCCCn1c(C)cc(C(=O)COC(=O)CSc2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C24H27NO4S/c1-17-13-22(18(2)25(17)11-6-12-28-3)23(26)15-29-24(27)16-30-21-10-9-19-7-4-5-8-20(19)14-21/h4-5,7-10,13-14H,6,11-12,15-16H2,1-3H3 |
| InChIKey | CNAWUSGRZBUAQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|