C26H21Cl2NO3S — CID 3372169
[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate (PubChem CID 3372169) has the molecular formula C26H21Cl2NO3S and a molecular weight of 498.43 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 3372169 |
| Molecular Formula | C26H21Cl2NO3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-naphthalen-2-ylsulfanylacetate |
| SMILES | Cc1cc(C(=O)COC(=O)CSc2ccc3ccccc3c2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2NO3S/c1-16-11-22(17(2)29(16)20-8-10-23(27)24(28)13-20)25(30)14-32-26(31)15-33-21-9-7-18-5-3-4-6-19(18)12-21/h3-13H,14-15H2,1-2H3 |
| InChIKey | GLPUULKQXQHBCE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|