C19H14BrCl2NO4 — CID 3888676
[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 3888676) has the molecular formula C19H14BrCl2NO4 and a molecular weight of 471.13 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 3888676 |
| Molecular Formula | C19H14BrCl2NO4 |
| Molecular Weight | 471.13 g/mol |
| Exact Mass | 468.95 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(Br)o2)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H14BrCl2NO4/c1-10-7-13(11(2)23(10)12-3-4-14(21)15(22)8-12)16(24)9-26-19(25)17-5-6-18(20)27-17/h3-8H,9H2,1-2H3 |
| InChIKey | ALPZQFHMDNSBAV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|