C22H18Cl2N2O5 — CID 3920370
[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 3920370) has the molecular formula C22H18Cl2N2O5 and a molecular weight of 461.30 g/mol. Its IUPAC name is [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3920370 |
| Molecular Formula | C22H18Cl2N2O5 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2nc(Cl)ccc2Cl)c(C)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H18Cl2N2O5/c1-12-9-15(17(27)11-31-22(28)21-16(23)4-6-20(24)25-21)13(2)26(12)14-3-5-18-19(10-14)30-8-7-29-18/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | LBMVWSVUOYXTKY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|