C22H19ClN2O5 — CID 18229075
[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-5-chlorobenzoate (PubChem CID 18229075) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-5-chlorobenzoate.
| Compound Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 18229075 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-5-chlorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc(Cl)ccc2N)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19ClN2O5/c1-12-7-16(13(2)25(12)15-4-6-20-21(9-15)30-11-29-20)19(26)10-28-22(27)17-8-14(23)3-5-18(17)24/h3-9H,10-11,24H2,1-2H3 |
| InChIKey | GCSOPMYYIMKBKB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|