C21H16Cl4N2O3 — CID 3570784
[2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 3570784) has the molecular formula C21H16Cl4N2O3 and a molecular weight of 486.18 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 3570784 |
| Molecular Formula | C21H16Cl4N2O3 |
| Molecular Weight | 486.18 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc(Cl)cc(Cl)c2N)c(C)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl4N2O3/c1-10-5-14(11(2)27(10)13-3-4-16(23)17(24)8-13)19(28)9-30-21(29)15-6-12(22)7-18(25)20(15)26/h3-8H,9,26H2,1-2H3 |
| InChIKey | PXYATMQYRAVDGS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.18 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|