C20H17Cl2N3O4 — CID 55998812
[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate (PubChem CID 55998812) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is [2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 55998812 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | [2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 1-methyl-6-oxopyridazine-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(=O)n(C)n2)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O4/c1-11-6-16(12(2)25(11)15-8-13(21)7-14(22)9-15)18(26)10-29-20(28)17-4-5-19(27)24(3)23-17/h4-9H,10H2,1-3H3 |
| InChIKey | GTBCLKYZKYIEQR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|