C21H19Cl2NO3 — CID 7262906
2-(3,5-dichlorophenoxy)-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 7262906) has the molecular formula C21H19Cl2NO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(3,5-dichlorophenoxy)-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 7262906 |
| Molecular Formula | C21H19Cl2NO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)COc3cc(Cl)cc(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C21H19Cl2NO3/c1-13-8-20(14(2)24(13)17-4-6-18(26-3)7-5-17)21(25)12-27-19-10-15(22)9-16(23)11-19/h4-11H,12H2,1-3H3 |
| InChIKey | HEKCCDWPXCEPJA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|