C21H19Cl2NO2S — CID 3312316
2-(2,5-dichlorophenyl)sulfanyl-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 3312316) has the molecular formula C21H19Cl2NO2S and a molecular weight of 420.36 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 3312316 |
| Molecular Formula | C21H19Cl2NO2S |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)CSc3cc(Cl)ccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C21H19Cl2NO2S/c1-13-10-18(14(2)24(13)16-5-7-17(26-3)8-6-16)20(25)12-27-21-11-15(22)4-9-19(21)23/h4-11H,12H2,1-3H3 |
| InChIKey | YYWOKUQYBQXXJE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|