C22H19ClN2O2S2 — CID 4211864
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 4211864) has the molecular formula C22H19ClN2O2S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 4211864 |
| Molecular Formula | C22H19ClN2O2S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-1-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)CSc3nc4cc(Cl)ccc4s3)c2C)cc1 |
| InChI | InChI=1S/C22H19ClN2O2S2/c1-13-10-18(14(2)25(13)16-5-7-17(27-3)8-6-16)20(26)12-28-22-24-19-11-15(23)4-9-21(19)29-22/h4-11H,12H2,1-3H3 |
| InChIKey | NWBHGWAWUGSTDR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|