C22H18ClN3OS3 — CID 3887273
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 3887273) has the molecular formula C22H18ClN3OS3 and a molecular weight of 472.06 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 3887273 |
| Molecular Formula | C22H18ClN3OS3 |
| Molecular Weight | 472.06 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2nn(-c3ccc(Cl)cc3)c(=S)s2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3OS3/c1-14-12-19(15(2)25(14)17-6-4-3-5-7-17)20(27)13-29-21-24-26(22(28)30-21)18-10-8-16(23)9-11-18/h3-12H,13H2,1-2H3 |
| InChIKey | MJINOHNNGOCDDS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.06 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|