C18H16N2O3S3 — CID 7420034
1-(2,4-dimethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone (PubChem CID 7420034) has the molecular formula C18H16N2O3S3 and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 7420034 |
| Molecular Formula | C18H16N2O3S3 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(C(=O)CSc2nn(-c3ccccc3)c(=S)s2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O3S3/c1-22-13-8-9-14(16(10-13)23-2)15(21)11-25-17-19-20(18(24)26-17)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | WUAMXBTUTXNFOI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|