C20H21N3O3S3 — CID 42351961
N-(2,5-diethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 42351961) has the molecular formula C20H21N3O3S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 42351961 |
| Molecular Formula | C20H21N3O3S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CSc2nn(-c3ccccc3)c(=S)s2)c1 |
| InChI | InChI=1S/C20H21N3O3S3/c1-3-25-15-10-11-17(26-4-2)16(12-15)21-18(24)13-28-19-22-23(20(27)29-19)14-8-6-5-7-9-14/h5-12H,3-4,13H2,1-2H3,(H,21,24) |
| InChIKey | LOCZRWSCQWYNJH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|