C15H12N4O2S4 — CID 7994260
2-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 7994260) has the molecular formula C15H12N4O2S4 and a molecular weight of 408.56 g/mol. Its IUPAC name is 2-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 7994260 |
| Molecular Formula | C15H12N4O2S4 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 2-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CSc1nn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C15H12N4O2S4/c16-12(21)10-6-7-23-13(10)17-11(20)8-24-14-18-19(15(22)25-14)9-4-2-1-3-5-9/h1-7H,8H2,(H2,16,21)(H,17,20) |
| InChIKey | AJQWMXMTAYKPMA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|