C14H10N2OS4 — CID 7994479
2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylethanone (PubChem CID 7994479) has the molecular formula C14H10N2OS4 and a molecular weight of 350.52 g/mol. Its IUPAC name is 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 7994479 |
| Molecular Formula | C14H10N2OS4 |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylethanone |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)c1cccs1 |
| InChI | InChI=1S/C14H10N2OS4/c17-11(12-7-4-8-19-12)9-20-13-15-16(14(18)21-13)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | KISBVTYOXJBQIW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|