C16H13FN2OS4 — CID 7528623
4-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 7528623) has the molecular formula C16H13FN2OS4 and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7528623 |
| Molecular Formula | C16H13FN2OS4 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCSc1nn(-c2ccc(F)cc2)c(=S)s1)c1cccs1 |
| InChI | InChI=1S/C16H13FN2OS4/c17-11-5-7-12(8-6-11)19-16(21)24-15(18-19)23-10-1-3-13(20)14-4-2-9-22-14/h2,4-9H,1,3,10H2 |
| InChIKey | YMDBWTCCFIIARF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|