C18H15FN4O2S3 — CID 4273005
N-(4-acetamidophenyl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4273005) has the molecular formula C18H15FN4O2S3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4273005 |
| Molecular Formula | C18H15FN4O2S3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nn(-c3ccc(F)cc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C18H15FN4O2S3/c1-11(24)20-13-4-6-14(7-5-13)21-16(25)10-27-17-22-23(18(26)28-17)15-8-2-12(19)3-9-15/h2-9H,10H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | PMAAFOVOEMEUOW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|