C18H15N3O3S3 — CID 39922153
methyl 4-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 39922153) has the molecular formula C18H15N3O3S3 and a molecular weight of 417.54 g/mol. Its IUPAC name is methyl 4-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39922153 |
| Molecular Formula | C18H15N3O3S3 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | methyl 4-[[2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nn(-c3ccccc3)c(=S)s2)cc1 |
| InChI | InChI=1S/C18H15N3O3S3/c1-24-16(23)12-7-9-13(10-8-12)19-15(22)11-26-17-20-21(18(25)27-17)14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,19,22) |
| InChIKey | GFBBSKNAGMCFKG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|