C17H11ClN4OS3 — CID 4679833
N-(3-chloro-4-cyanophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 4679833) has the molecular formula C17H11ClN4OS3 and a molecular weight of 418.96 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4679833 |
| Molecular Formula | C17H11ClN4OS3 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | N#Cc1ccc(NC(=O)CSc2nn(-c3ccccc3)c(=S)s2)cc1Cl |
| InChI | InChI=1S/C17H11ClN4OS3/c18-14-8-12(7-6-11(14)9-19)20-15(23)10-25-16-21-22(17(24)26-16)13-4-2-1-3-5-13/h1-8H,10H2,(H,20,23) |
| InChIKey | IIJWLVMLLFVQGR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|