C16H10Cl2IN3OS3 — CID 3631766
2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 3631766) has the molecular formula C16H10Cl2IN3OS3 and a molecular weight of 554.29 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 3631766 |
| Molecular Formula | C16H10Cl2IN3OS3 |
| Molecular Weight | 554.29 g/mol |
| Exact Mass | 552.84 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | O=C(CSc1nn(-c2ccc(Cl)c(Cl)c2)c(=S)s1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C16H10Cl2IN3OS3/c17-12-5-4-11(7-13(12)18)22-16(24)26-15(21-22)25-8-14(23)20-10-3-1-2-9(19)6-10/h1-7H,8H2,(H,20,23) |
| InChIKey | VPJZFVBZMWVDBH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.29 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|